|
CAS#: 1085-91-2 Product: 2-Ethyl-2-Naphthalen-1-Ylbutanoic Acid No suppilers available for the product. |
| Name | 2-Ethyl-2-Naphthalen-1-Ylbutanoic Acid |
|---|---|
| Synonyms | 2-Ethyl-2-(1-Naphthyl)Butanoic Acid; 2-Ethyl-2-(1-Naphthyl)Butyric Acid; 2-Ethyl-2-Naphthalen-1-Yl-Butanoic Acid |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 |
| CAS Registry Number | 1085-91-2 |
| SMILES | C2=C(C(C(O)=O)(CC)CC)C1=CC=CC=C1C=C2 |
| InChI | 1S/C16H18O2/c1-3-16(4-2,15(17)18)14-11-7-9-12-8-5-6-10-13(12)14/h5-11H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | NONNPKGLUCHFEW-UHFFFAOYSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.395°C at 760 mmHg (Cal.) |
| Flash point | 297.197°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-2-Naphthalen-1-Ylbutanoic Acid |