| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 1-(Chloromethyl)Pyrene |
|---|---|
| Synonyms | Nsc133487; 1-Chloromethylpyrene; Brn 1967710 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H11Cl |
| Molecular Weight | 250.73 |
| CAS Registry Number | 1086-00-6 |
| SMILES | C3=CC1=CC=CC2=C1C4=C(C=C2)C=CC(=C34)CCl |
| InChI | 1S/C17H11Cl/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-9H,10H2 |
| InChIKey | MVNXSXOJYGSNQZ-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.089°C at 760 mmHg (Cal.) |
| Flash point | 201.163°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Vyacheslav V. Filichev and Erik B. Pedersen. Intercalating nucleic acids (INAs) with insertion of N-(pyren-1-ylmethyl)-(3R,4R)-4-(hydroxymethyl)pyrrolidin-3-ol. DNA (RNA) duplex and DNA three-way junction stabilities, Org. Biomol. Chem., 2003, 1, 100. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(Chloromethyl)Pyrene |