Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Iodo-N,N,alpha,alpha-Tetramethyl-Benzeneethanamine |
|---|---|
| Synonyms | 1-(4-Iodophenyl)-N,N,2-Trimethyl-Propan-2-Amine; [2-(4-Iodophenyl)-1,1-Dimethyl-Ethyl]-Dimethyl-Amine; N,N-Dimethyl-4-Iodophentermine |
| Molecular Structure |  |
| Molecular Formula | C12H18IN |
| Molecular Weight | 303.19 |
| CAS Registry Number | 108731-71-1 |
| SMILES | C1=CC(=CC=C1CC(N(C)C)(C)C)I |
| InChI | 1S/C12H18IN/c1-12(2,14(3)4)9-10-5-7-11(13)8-6-10/h5-8H,9H2,1-4H3 |
| InChIKey | PZIVQNCOTRXRLT-UHFFFAOYSA-N |
| Density | 1.393g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.19°C at 760 mmHg (Cal.) |
| Flash point | 132.326°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Iodo-N,N,alpha,alpha-Tetramethyl-Benzeneethanamine |