|
CAS#: 109349-02-2 Product: (2,6-Dichlorophenoxy)Methyl Methyl Cyanocarbonodithioimidate No suppilers available for the product. |
| Name | (2,6-Dichlorophenoxy)Methyl Methyl Cyanocarbonodithioimidate |
|---|---|
| Synonyms | [(2,6-Dichlorophenoxy)methyl] methyl; [(2,6-Dic |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8Cl2N2OS2 |
| Molecular Weight | 307.22 |
| CAS Registry Number | 109349-02-2 |
| SMILES | Clc1cccc(Cl)c1OCSC(=N\C#N)\SC |
| InChI | 1S/C10H8Cl2N2OS2/c1-16-10(14-5-13)17-6-15-9-7(11)3-2-4-8(9)12/h2-4H,6H2,1H3/b14-10+ |
| InChIKey | FWTXKQLCTNDYMQ-GXDHUFHOSA-N |
| Density | 1.397g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.293°C at 760 mmHg (Cal.) |
| Flash point | 212.824°C (Cal.) |
| Refractive index | 1.618 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,6-Dichlorophenoxy)Methyl Methyl Cyanocarbonodithioimidate |