Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (431) 5606-600 | |||
|
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | Ethyl 4-[(E)-2-Phenylvinyl]Benzoate |
|---|---|
| Synonyms | Benzoicacid,4-(2-phenylethenyl)-,ethylester; Ethyl Stilbene-4-carboxylate; ETHYLSTILBENE-4-CARBOXYLATE |
| Molecular Structure | ![CAS#: 109463-48-1， Ethyl 4-[(E)-2-Phenylvinyl]Benzoate](/moreStructures/109463-48-1.gif) |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 |
| CAS Registry Number | 109463-48-1 |
| SMILES | O=C(OCC)c2ccc(\C=C\c1ccccc1)cc2 |
| InChI | 1S/C17H16O2/c1-2-19-17(18)16-12-10-15(11-13-16)9-8-14-6-4-3-5-7-14/h3-13H,2H2,1H3/b9-8+ |
| InChIKey | RBQGAPDZGPQIDL-CMDGGOBGSA-N |
| Density | 1.111g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.023°C at 760 mmHg (Cal.) |
| Flash point | 169.803°C (Cal.) |
| Refractive index | 1.623 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-[(E)-2-Phenylvinyl]Benzoate |