Online Database of Chemicals from Around the World
|
CAS#: 109963-13-5 Product: S-(Thiiran-2-Ylmethyl) 4-Chlorobenzenecarbothioate No suppilers available for the product. |
| Name | S-(Thiiran-2-Ylmethyl) 4-Chlorobenzenecarbothioate |
|---|---|
| Synonyms | 4-Chlorobenzenecarbothioic Acid S-(2-Thiiranylmethyl) Ester; 4-Chlorothiobenzoic Acid S-(Thiiran-2-Ylmethyl) Ester; 4-Chlorophenyl Thiiran-2-Ylmethylthio Ketone |
| Molecular Structure |  |
| Molecular Formula | C10H9ClOS2 |
| Molecular Weight | 244.75 |
| CAS Registry Number | 109963-13-5 |
| SMILES | C2=C(C(SCC1CS1)=O)C=CC(=C2)Cl |
| InChI | 1S/C10H9ClOS2/c11-8-3-1-7(2-4-8)10(12)14-6-9-5-13-9/h1-4,9H,5-6H2 |
| InChIKey | SZLZSEGHHKJSBT-UHFFFAOYSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.953°C at 760 mmHg (Cal.) |
| Flash point | 181.17°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for S-(Thiiran-2-Ylmethyl) 4-Chlorobenzenecarbothioate |