Online Database of Chemicals from Around the World
|
CAS#: 110905-37-8 Product: (E)-4-Diethoxyphosphorylbut-2-Enal No suppilers available for the product. |
| Name | (E)-4-Diethoxyphosphorylbut-2-Enal |
|---|---|
| Synonyms | 4-Depb; Phosphonic Acid, (4-Oxo-2-Butenyl)-, Diethyl Ester, (E)-; 4-(Diethylphosphono)-2-Butenal |
| Molecular Structure |  |
| Molecular Formula | C8H15O4P |
| Molecular Weight | 206.18 |
| CAS Registry Number | 110905-37-8 |
| SMILES | C(\C=C\C=O)[P](=O)(OCC)OCC |
| InChI | 1S/C8H15O4P/c1-3-11-13(10,12-4-2)8-6-5-7-9/h5-7H,3-4,8H2,1-2H3/b6-5+ |
| InChIKey | IIVXNWZBMVVKJU-AATRIKPKSA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.199°C at 760 mmHg (Cal.) |
| Flash point | 157.05°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-4-Diethoxyphosphorylbut-2-Enal |