Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Potassium 4-Methoxyphenolate |
|---|---|
| Synonyms | Phenol, 4-Methoxy-, Potassium Salt; Potassium P-Methoxyphenolate |
| Molecular Structure |  |
| Molecular Formula | C7H7KO2 |
| Molecular Weight | 162.23 |
| CAS Registry Number | 1122-93-6 |
| EINECS | 214-366-6 |
| SMILES | C1=C(OC)C=CC(=C1)[O-].[K+] |
| InChI | 1S/C7H8O2.K/c1-9-7-4-2-6(8)3-5-7;/h2-5,8H,1H3;/q;+1/p-1 |
| InChIKey | NOCQQZLSUGMTIS-UHFFFAOYSA-M |
| Boiling point | 243°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 120.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 4-Methoxyphenolate |