|
CAS#: 112489-57-3 Product: Methyl (E,4S)-4-(Phenylmethoxy)Pent-2-Enoate No suppilers available for the product. |
| Name | Methyl (E,4S)-4-(Phenylmethoxy)Pent-2-Enoate |
|---|---|
| Synonyms | (E,4S)-4-(Phenylmethoxy)Pent-2-Enoic Acid Methyl Ester; (E,4S)-4-(Benzyloxy)Pent-2-Enoic Acid Methyl Ester; Sbb017004 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 112489-57-3 |
| SMILES | [C@H](\C=C\C(OC)=O)(OCC1=CC=CC=C1)C |
| InChI | 1S/C13H16O3/c1-11(8-9-13(14)15-2)16-10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3/b9-8+/t11-/m0/s1 |
| InChIKey | HQXFTCDXKMAFJW-FBOQAHMBSA-N |
| Density | 1.055g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.8°C at 760 mmHg (Cal.) |
| Flash point | 127.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (E,4S)-4-(Phenylmethoxy)Pent-2-Enoate |