|
CAS#: 112573-73-6 Product: Phenylmethyl 2-[[(2S)-2-(Acetylsulfanylmethyl)-3-Phenylpropanoyl]Amino]Acetate No suppilers available for the product. |
| Name | Phenylmethyl 2-[[(2S)-2-(Acetylsulfanylmethyl)-3-Phenylpropanoyl]Amino]Acetate |
|---|---|
| Synonyms | Phenylmethyl 2-[[(2S)-2-(Acetylsulfanylmethyl)-3-Phenyl-Propanoyl]Amino]Acetate; 2-[[(2S)-2-[(Acetylthio)Methyl]-1-Oxo-3-Phenylpropyl]Amino]Acetic Acid Phenylmethyl Ester; 2-[[(2S)-2-[(Acetylthio)Methyl]-3-Phenyl-Propanoyl]Amino]Acetic Acid Benzyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.48 |
| CAS Registry Number | 112573-73-6 |
| SMILES | [C@H](CC1=CC=CC=C1)(C(NCC(OCC2=CC=CC=C2)=O)=O)CSC(C)=O |
| InChI | 1S/C21H23NO4S/c1-16(23)27-15-19(12-17-8-4-2-5-9-17)21(25)22-13-20(24)26-14-18-10-6-3-7-11-18/h2-11,19H,12-15H2,1H3,(H,22,25)/t19-/m1/s1 |
| InChIKey | ODUOJXZPIYUATO-LJQANCHMSA-N |
| Density | 1.207g/cm3 (Cal.) |
|---|---|
| Boiling point | 574.502°C at 760 mmHg (Cal.) |
| Flash point | 301.248°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenylmethyl 2-[[(2S)-2-(Acetylsulfanylmethyl)-3-Phenylpropanoyl]Amino]Acetate |