|
CAS#: 1129-21-1 Product: 4-(1,1-Dimethylethyl)-3,5-Cyclohexadiene-1,2-Dione No suppilers available for the product. |
| Name | 4-(1,1-Dimethylethyl)-3,5-Cyclohexadiene-1,2-Dione |
|---|---|
| Synonyms | 4-Tert-Butyl-1,2-Benzoquinone; 4-Tert-Butyl-O-Benzoquinone; 3,5-Cyclohexadiene-1,2-Dione, 4-(1,1-Dimethylethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 |
| CAS Registry Number | 1129-21-1 |
| SMILES | CC(C)(C)C1=CC(=O)C(=O)C=C1 |
| InChI | 1S/C10H12O2/c1-10(2,3)7-4-5-8(11)9(12)6-7/h4-6H,1-3H3 |
| InChIKey | WZJTXQRITQYKKG-UHFFFAOYSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.232°C at 760 mmHg (Cal.) |
| Flash point | 94.713°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1,1-Dimethylethyl)-3,5-Cyclohexadiene-1,2-Dione |