|
CAS#: 1131-02-8 Product: 5,5-Dimethyl-2-Prop-2-Enyl-Cyclohexane-1,3-Dione No suppilers available for the product. |
| Name | 5,5-Dimethyl-2-Prop-2-Enyl-Cyclohexane-1,3-Dione |
|---|---|
| Synonyms | 2-Allyl-5,5-Dimethyl-Cyclohexane-1,3-Dione; 2-Allyl-5,5-Dimethylcyclohexane-1,3-Dione; 2-Allyl-5,5-Dimethyl-Cyclohexane-1,3-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 |
| CAS Registry Number | 1131-02-8 |
| SMILES | C(C1C(CC(C)(C)CC1=O)=O)C=C |
| InChI | 1S/C11H16O2/c1-4-5-8-9(12)6-11(2,3)7-10(8)13/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | BTNZTGPJWZBPOJ-UHFFFAOYSA-N |
| Density | 0.964g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.18°C at 760 mmHg (Cal.) |
| Flash point | 97.697°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Dimethyl-2-Prop-2-Enyl-Cyclohexane-1,3-Dione |