Online Database of Chemicals from Around the World
|
CAS#: 113216-88-9 Product: (3alpha,9R)-6'-Methoxy-10,11-Dihydrocinchonan-9-Yl 4-Chlorobenzoate No suppilers available for the product. |
| Name | (3alpha,9R)-6'-Methoxy-10,11-Dihydrocinchonan-9-Yl 4-Chlorobenzoate |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C27H29ClN2O3 |
| Molecular Weight | 464.98 |
| CAS Registry Number | 113216-88-9 |
| SMILES | Clc1ccc(cc1)C(=O)O[C@@H](C3CC2CC[N@@]3C[C@H]2CC)c5ccnc4ccc(OC)cc45 |
| InChI | 1S/C27H29ClN2O3/c1-3-17-16-30-13-11-19(17)14-25(30)26(33-27(31)18-4-6-20(28)7-5-18)22-10-12-29-24-9-8-21(32-2)15-23(22)24/h4-10,12,15,17,19,25-26H,3,11,13-14,16H2,1-2H3/t17-,19?,25?,26-/m1/s1 |
| InChIKey | TXVNNFDXQZFMBQ-FCDCVOMCSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 597.996°C at 760 mmHg (Cal.) |
| Flash point | 315.457°C (Cal.) |
| Refractive index | 1.639 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (3alpha,9R)-6'-Methoxy-10,11-Dihydrocinchonan-9-Yl 4-Chlorobenzoate |