|
CAS#: 1133-54-6 Product: 6-Methoxy-3,3-Dimethyl-1-Indanone No suppilers available for the product. |
| Name | 6-Methoxy-3,3-Dimethyl-1-Indanone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 1133-54-6 |
| SMILES | COc1cc2c(cc1)C(C)(C)CC2=O |
| InChI | 1S/C12H14O2/c1-12(2)7-11(13)9-6-8(14-3)4-5-10(9)12/h4-6H,7H2,1-3H3 |
| InChIKey | YSDTWWGZZDDTHY-UHFFFAOYSA-N |
| Density | 1.072g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.599°C at 760 mmHg (Cal.) |
| Flash point | 135.107°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-3,3-Dimethyl-1-Indanone |