| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Cyclic hydrocarbon |
|---|---|
| Name | (+)-Longicyclene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 1137-12-8 |
| EINECS | 214-504-5 |
| SMILES | [C@@H]14[C@@H]2C3C([C@]1(CCCC2(C)C)C)(C3C4)C |
| InChI | 1S/C15H24/c1-13(2)6-5-7-14(3)9-8-10-12(11(9)13)15(10,14)4/h9-12H,5-8H2,1-4H3/t9-,10?,11-,12?,14+,15?/m1/s1 |
| InChIKey | WCEIQUQVIOGRBF-ZYBGGCANSA-N |
| Density | 0.991g/cm3 (Cal.) |
|---|---|
| Boiling point | 239.602°C at 760 mmHg (Cal.) |
| Flash point | 89.455°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (+)-Longicyclene |