Online Database of Chemicals from Around the World
|
CAS#: 1137-79-7 Product: N,N-Dimethyl-4-Biphenylamine No suppilers available for the product. |
| Name | N,N-Dimethyl-4-Biphenylamine |
|---|---|
| Synonyms | N,N-Dimethyl-4-Phenyl-Aniline; Dimethyl-(4-Phenylphenyl)Amine; 4-12-00-03242 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 |
| CAS Registry Number | 1137-79-7 |
| SMILES | C1=CC(=CC=C1N(C)C)C2=CC=CC=C2 |
| InChI | 1S/C14H15N/c1-15(2)14-10-8-13(9-11-14)12-6-4-3-5-7-12/h3-11H,1-2H3 |
| InChIKey | CYCPXOQAYQJEBC-UHFFFAOYSA-N |
| Density | 1.024g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.571°C at 760 mmHg (Cal.) |
| Flash point | 132.974°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-4-Biphenylamine |