Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
|
+41 (71) 858-2020 | |||
|
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Name | 1-[4-(Benzyloxy)-1H-Indol-3-Yl]Acetone |
|---|---|
| Synonyms | 4-Benzyloxyindole-3-acetone; B-1788 |
| Molecular Structure | ![CAS#: 113997-55-0， 1-[4-(Benzyloxy)-1H-Indol-3-Yl]Acetone](/moreStructures/113997-55-0.gif) |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.33 |
| CAS Registry Number | 113997-55-0 |
| SMILES | CC(=O)Cc1c[nH]c2c1c(ccc2)OCc3ccccc3 |
| InChI | 1S/C18H17NO2/c1-13(20)10-15-11-19-16-8-5-9-17(18(15)16)21-12-14-6-3-2-4-7-14/h2-9,11,19H,10,12H2,1H3 |
| InChIKey | BMFUYDUSMLVBHB-UHFFFAOYSA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.384°C at 760 mmHg (Cal.) |
| Flash point | 244.328°C (Cal.) |
| Refractive index | 1.639 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-[4-(Benzyloxy)-1H-Indol-3-Yl]Acetone |