|
CAS#: 114829-62-8 Product: 5-[{2-[4-(Benzyloxy)-3-Methoxyphenyl]Ethyl}(Methyl)Amino]-2-(3,4-Dimethoxyphenyl)-2-Isopropylpentanenitrile No suppilers available for the product. |
| Name | 5-[{2-[4-(Benzyloxy)-3-Methoxyphenyl]Ethyl}(Methyl)Amino]-2-(3,4-Dimethoxyphenyl)-2-Isopropylpentanenitrile |
|---|---|
| Synonyms | p-O-Desmethyl p-O-Benzyl Verapamil |
| Molecular Structure | ![]() |
| Molecular Formula | C33H42N2O4 |
| Molecular Weight | 530.70 |
| CAS Registry Number | 114829-62-8 |
| SMILES | CC(C)C(CCCN(C)CCc1ccc(c(c1)OC)OCc2ccccc2)(C#N)c3ccc(c(c3)OC)OC |
| InChI | 1S/C33H42N2O4/c1-25(2)33(24-34,28-14-16-29(36-4)32(22-28)38-6)18-10-19-35(3)20-17-26-13-15-30(31(21-26)37-5)39-23-27-11-8-7-9-12-27/h7-9,11-16,21-22,25H,10,17-20,23H2,1-6H3 |
| InChIKey | PWIBBBJJFPZJFC-UHFFFAOYSA-N |
| Density | 1.083g/cm3 (Cal.) |
|---|---|
| Boiling point | 662.483°C at 760 mmHg (Cal.) |
| Flash point | 354.457°C (Cal.) |
| Refractive index | 1.55 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[{2-[4-(Benzyloxy)-3-Methoxyphenyl]Ethyl}(Methyl)Amino]-2-(3,4-Dimethoxyphenyl)-2-Isopropylpentanenitrile |