| PepTech Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (781) 273-5400 | |||
![]() |
service@peptechcorp.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Tryptophan derivatives |
|---|---|
| Name | 5-Chloro-N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-Tryptophan |
| Synonyms | (S)-N-Boc-5-chlorotryptophan; L-N-Boc-5-chlorotryptophan |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 |
| CAS Registry Number | 114873-08-4 |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1c[nH]c2c1cc(cc2)Cl)C(=O)O |
| InChI | 1S/C16H19ClN2O4/c1-16(2,3)23-15(22)19-13(14(20)21)6-9-8-18-12-5-4-10(17)7-11(9)12/h4-5,7-8,13,18H,6H2,1-3H3,(H,19,22)(H,20,21)/t13-/m0/s1 |
| InChIKey | PZZXAZAYKCNQAL-ZDUSSCGKSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 560.777°C at 760 mmHg (Cal.) |
| Flash point | 292.947°C (Cal.) |
| Refractive index | 1.609 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-Tryptophan |