Online Database of Chemicals from Around the World
|
CAS#: 114996-73-5 Product: 4-(Chloromethyl)Benzoylformate No suppilers available for the product. |
| Name | 4-(Chloromethyl)Benzoylformate |
|---|---|
| Synonyms | 2-[4-(Chloromethyl)Phenyl]-2-Oxo-Acetic Acid; 2-[4-(Chloromethyl)Phenyl]-2-Keto-Acetic Acid; 2-[4-(Chloromethyl)Phenyl]-2-Oxo-Ethanoic Acid |
| Molecular Structure |  |
| Molecular Formula | C9H7ClO3 |
| Molecular Weight | 198.61 |
| CAS Registry Number | 114996-73-5 |
| SMILES | C1=CC(=CC=C1C(C(=O)O)=O)CCl |
| InChI | 1S/C9H7ClO3/c10-5-6-1-3-7(4-2-6)8(11)9(12)13/h1-4H,5H2,(H,12,13) |
| InChIKey | PTGQUDJBQDECBL-UHFFFAOYSA-N |
| Density | 1.386g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.841°C at 760 mmHg (Cal.) |
| Flash point | 162.354°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Chloromethyl)Benzoylformate |