Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | beta-(Z)-Santalol |
|---|---|
| Synonyms | (Z)- .Alpha.-Santalool; C09719; Alpha-Santalol |
| Molecular Structure |  |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 115-71-9 |
| EINECS | 204-102-8 |
| SMILES | C(C2(C1(C3C1CC2C3)C)C)C\C=C(/CO)C |
| InChI | 1S/C15H24O/c1-10(9-16)5-4-6-14(2)11-7-12-13(8-11)15(12,14)3/h5,11-13,16H,4,6-9H2,1-3H3/b10-5- |
| InChIKey | PDEQKAVEYSOLJX-YHYXMXQVSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.503°C at 760 mmHg (Cal.) |
| Flash point | 138.585°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-(Z)-Santalol |