Online Database of Chemicals from Around the World
|
CAS#: 115313-22-9 Product: Serazapine No suppilers available for the product. |
| Name | Serazapine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.44 |
| CAS Registry Number | 115313-22-9 |
| SMILES | C1=CC=CC2=C1[N]3C(=C2C(OC)=O)C5N(C4=C(C3)C=CC=C4)CCN(C5)C |
| InChI | 1S/C22H23N3O2/c1-23-11-12-24-17-9-5-3-7-15(17)13-25-18-10-6-4-8-16(18)20(22(26)27-2)21(25)19(24)14-23/h3-10,19H,11-14H2,1-2H3 |
| InChIKey | WPGUWABWNUSPMW-UHFFFAOYSA-N |
| Density | 1.298g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.052°C at 760 mmHg (Cal.) |
| Flash point | 294.324°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Serazapine |