Online Database of Chemicals from Around the World
|
CAS#: 115375-37-6 Product: 6-Methoxy-7-Bromoestradiol No suppilers available for the product. |
| Name | 6-Methoxy-7-Bromoestradiol |
|---|---|
| Synonyms | 6-Mb-Estradiol; 6-Methoxy-7-Bromoestradiol; 6Beta-Methoxy-7Alpha-Bromoestradiol |
| Molecular Structure |  |
| Molecular Formula | C19H25BrO3 |
| Molecular Weight | 381.31 |
| CAS Registry Number | 115375-37-6 |
| SMILES | [C@@H]2(C1=CC(=CC=C1[C@@H]3[C@@H]([C@@H]2Br)[C@H]4[C@](CC3)([C@H](CC4)O)C)O)OC |
| InChI | 1S/C19H25BrO3/c1-19-8-7-12-11-4-3-10(21)9-13(11)18(23-2)17(20)16(12)14(19)5-6-15(19)22/h3-4,9,12,14-18,21-22H,5-8H2,1-2H3/t12-,14+,15+,16-,17+,18+,19+/m1/s1 |
| InChIKey | IRFSYPWIHGNEAN-CORSCNNSSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.205°C at 760 mmHg (Cal.) |
| Flash point | 258.734°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-7-Bromoestradiol |