Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (2S)-2-[(5-Nitro-2-Pyridinyl)Amino]-3-Phenyl-1-Propanol |
|---|---|
| Synonyms | (S)-N-(5-Nitro-2-pyridyl)phenylalaninol |
| Molecular Structure | ![CAS#: 115416-53-0， (2S)-2-[(5-Nitro-2-Pyridinyl)Amino]-3-Phenyl-1-Propanol](/moreStructures/115416-53-0.gif) |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 |
| CAS Registry Number | 115416-53-0 |
| SMILES | c1ccc(cc1)C[C@@H](CO)Nc2ccc(cn2)[N+](=O)[O-] |
| InChI | 1S/C14H15N3O3/c18-10-12(8-11-4-2-1-3-5-11)16-14-7-6-13(9-15-14)17(19)20/h1-7,9,12,18H,8,10H2,(H,15,16)/t12-/m0/s1 |
| InChIKey | XQQHMEFZBTXUTC-LBPRGKRZSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Melting point | 117°C (Expl.) |
| Boiling point | 523.053°C at 760 mmHg (Cal.) |
| Flash point | 270.133°C (Cal.) |
| Refractive index | 1.658 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2S)-2-[(5-Nitro-2-Pyridinyl)Amino]-3-Phenyl-1-Propanol |