Online Database of Chemicals from Around the World
|
CAS#: 115510-05-9 Product: Cholestane-3,5,6-Triol No suppilers available for the product. |
| Name | Cholestane-3,5,6-Triol |
|---|---|
| Synonyms | (8S,9S,10R,13R,14S,17R)-17-[(1R)-1,5-Dimethylhexyl]-10,13-Dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-Tetradecahydrocyclopenta[A]Phenanthrene-3,5,6-Triol; Cholestane-3,5,6-Triol |
| Molecular Structure |  |
| Molecular Formula | C27H48O3 |
| Molecular Weight | 420.67 |
| CAS Registry Number | 115510-05-9 |
| SMILES | [C@@]12(CCC(CC1(C(C[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4[C@@H](CCCC(C)C)C)C)O)O)O)C |
| InChI | 1S/C27H48O3/c1-17(2)7-6-8-18(3)21-9-10-22-20-15-24(29)27(30)16-19(28)11-14-26(27,5)23(20)12-13-25(21,22)4/h17-24,28-30H,6-16H2,1-5H3/t18-,19?,20+,21-,22+,23+,24?,25-,26-,27?/m1/s1 |
| InChIKey | YMMFNKXZULYSOQ-MHZASZHRSA-N |
| Density | 1.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.721°C at 760 mmHg (Cal.) |
| Flash point | 212.491°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cholestane-3,5,6-Triol |