Online Database of Chemicals from Around the World
| C D N Isotopes Inc. | Canada | Inquire | ||
|---|---|---|---|---|
 |
+1 (800) 565-4696 / (514) 697-6254 | |||
 |
info@cdnisotopes.com, | |||
| Chemical manufacturer since 1993 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1,6-(1,1,6,6-2H4)Hexanediamine |
|---|---|
| Synonyms | 1,6-Diamino(hexane-1,1,6,6-d4); 1,6-DIAMINOHEXANE-1,1,6,6-D4; 1,6-Hexane-1,1,6,6-d4-diamine |
| Molecular Structure |  |
| Molecular Formula | C6H12D4N2 |
| Molecular Weight | 120.23 |
| CAS Registry Number | 115797-49-4 |
| SMILES | [2H]C([2H])(N)CCCCC([2H])([2H])N |
| InChI | 1S/C6H16N2/c7-5-3-1-2-4-6-8/h1-8H2/i5D2,6D2 |
| InChIKey | NAQMVNRVTILPCV-NZLXMSDQSA-N |
| Density | 0.891g/cm3 (Cal.) |
|---|---|
| Boiling point | 205.018°C at 760 mmHg (Cal.) |
| Flash point | 81.111°C (Cal.) |
| Refractive index | 1.459 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,6-(1,1,6,6-2H4)Hexanediamine |