|
CAS#: 115978-59-1 Product: 4-(trans-4-Butylcyclohexyl)Phenyl (1R,1'S,4R,4'S)-4'-Propyl-1,1'-Bi(Cyclohexyl)-4-Carboxylate No suppilers available for the product. |
| Name | 4-(trans-4-Butylcyclohexyl)Phenyl (1R,1'S,4R,4'S)-4'-Propyl-1,1'-Bi(Cyclohexyl)-4-Carboxylate |
|---|---|
| Synonyms | TRANS,TRA |
| Molecular Structure | ![]() |
| Molecular Formula | C32H50O2 |
| Molecular Weight | 466.74 |
| CAS Registry Number | 115978-59-1 |
| SMILES | CCCC[C@H]1CC[C@@H](CC1)c2ccc(cc2)OC(=O)[C@H]3CC[C@@H](CC3)C4CC[C@@H](CC4)CCC |
| InChI | 1S/C32H50O2/c1-3-5-7-25-10-14-27(15-11-25)29-20-22-31(23-21-29)34-32(33)30-18-16-28(17-19-30)26-12-8-24(6-4-2)9-13-26/h20-28,30H,3-19H2,1-2H3/t24-,25-,26?,27-,28-,30- |
| InChIKey | LCOGJPXBBIRCAF-QOARDTQZSA-N |
| Density | 0.981g/cm3 (Cal.) |
|---|---|
| Boiling point | 562.157°C at 760 mmHg (Cal.) |
| Flash point | 166.546°C (Cal.) |
| Refractive index | 1.512 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(trans-4-Butylcyclohexyl)Phenyl (1R,1'S,4R,4'S)-4'-Propyl-1,1'-Bi(Cyclohexyl)-4-Carboxylate |