Online Database of Chemicals from Around the World
|
CAS#: 116-59-6 Product: 17,20,21-Trihydroxypregn-4-Ene-3,11-Dione No suppilers available for the product. |
| Name | 17,20,21-Trihydroxypregn-4-Ene-3,11-Dione |
|---|---|
| Synonyms | 4-Pregnene-17a,20b,21-triol-3,11-dione |
| Molecular Structure |  |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.46 |
| CAS Registry Number | 116-59-6 |
| SMILES | O=C2CC4(C(C3CC\C1=C\C(=O)CCC1(C)C23)CCC4(O)C(O)CO)C |
| InChI | 1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-15,17-18,22,25-26H,3-8,10-11H2,1-2H3 |
| InChIKey | XBIDABJJGYNJTK-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 588.152°C at 760 mmHg (Cal.) |
| Flash point | 323.539°C (Cal.) |
| Refractive index | 1.595 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17,20,21-Trihydroxypregn-4-Ene-3,11-Dione |