Online Database of Chemicals from Around the World
| Name | Diethylglyoxal Bis(Guanylhydrazone) |
|---|---|
| Synonyms | 123475-65-0 (Sulfate); 144443-19-6 (Conjugate Diacid); 163800-16-6 ((E,E)-) |
| Molecular Structure |  |
| Molecular Formula | C8H18N8 |
| Molecular Weight | 226.28 |
| CAS Registry Number | 116173-27-4 |
| SMILES | C(C(=N/N=C(N)N)/C(=N/N=C(N)N)CC)C |
| InChI | 1S/C8H18N8/c1-3-5(13-15-7(9)10)6(4-2)14-16-8(11)12/h3-4H2,1-2H3,(H4,9,10,15)(H4,11,12,16)/b13-5-,14-6+ |
| InChIKey | HXWLLFLQUZOBFF-FUJGBLOQSA-N |
| Density | 1.366g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.045°C at 760 mmHg (Cal.) |
| Flash point | 223.56°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethylglyoxal Bis(Guanylhydrazone) |
