| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Synchem OHG | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (5662) 40873-0 | |||
![]() |
info@synchem.de | |||
| Chemical manufacturer | ||||
| Name | 5,7-Dimethoxy-3-(4-Methoxyphenyl)-4H-1-Benzopyran-4-One |
|---|---|
| Synonyms | 5,7-Dimethoxy-3-(4-Methoxyphenyl)-4-Chromenone; 5,7-Dimethoxy-3-(4-Methoxyphenyl)Chromone; St060219 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 |
| CAS Registry Number | 1162-82-9 |
| SMILES | C1=C2C(=C(C=C1OC)OC)C(C(=CO2)C3=CC=C(C=C3)OC)=O |
| InChI | 1S/C18H16O5/c1-20-12-6-4-11(5-7-12)14-10-23-16-9-13(21-2)8-15(22-3)17(16)18(14)19/h4-10H,1-3H3 |
| InChIKey | PVVORTURQPBPEQ-UHFFFAOYSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.493°C at 760 mmHg (Cal.) |
| Flash point | 225.491°C (Cal.) |
| (1) | H.-Q. Li, Z.-P. Xiao, Y. Han, R.-Q. Fang and H.-L. Zhu. 5,7-Dimethoxy-3-(4-methoxyphenyl)-4H-chromen-4-one, Acta Cryst. (2007). E63, o3923 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5,7-Dimethoxy-3-(4-Methoxyphenyl)-4H-1-Benzopyran-4-One |