Online Database of Chemicals from Around the World
|
CAS#: 116211-53-1 Product: Dihydroisotryptophan No suppilers available for the product. |
| Name | Dihydroisotryptophan |
|---|---|
| Synonyms | 2-Amino-3-Indolin-2-Yl-Propanoic Acid; 2-Amino-3-(2-Indolinyl)Propanoic Acid; 2-Amino-3-Indolin-2-Yl-Propionic Acid |
| Molecular Structure |  |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 |
| CAS Registry Number | 116211-53-1 |
| SMILES | C1=CC=CC2=C1CC(N2)CC(C(=O)O)N |
| InChI | 1S/C11H14N2O2/c12-9(11(14)15)6-8-5-7-3-1-2-4-10(7)13-8/h1-4,8-9,13H,5-6,12H2,(H,14,15) |
| InChIKey | MSWOSWPRORBFBB-UHFFFAOYSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.108°C at 760 mmHg (Cal.) |
| Flash point | 211.503°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihydroisotryptophan |