Online Database of Chemicals from Around the World
|
CAS#: 116271-40-0 Product: N-Desmethyleclanamine No suppilers available for the product. |
| Name | N-Desmethyleclanamine |
|---|---|
| Synonyms | N-(3,4-Dichlorophenyl)-N-[(1R,2R)-2-Methylaminocyclopentyl]Propionamide; N-Demethyleclanamine; N-Desmethyleclanamine |
| Molecular Structure |  |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 |
| CAS Registry Number | 116271-40-0 |
| SMILES | [C@H]2(N(C1=CC=C(Cl)C(=C1)Cl)C(=O)CC)[C@H](NC)CCC2 |
| InChI | 1S/C15H20Cl2N2O/c1-3-15(20)19(14-6-4-5-13(14)18-2)10-7-8-11(16)12(17)9-10/h7-9,13-14,18H,3-6H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | DJHNZQSKIXGMRQ-ZIAGYGMSSA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.746°C at 760 mmHg (Cal.) |
| Flash point | 221.565°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Desmethyleclanamine |