| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | (4-Bromo-4-Butyl-6-Fluoro-1,5-Cyclohexadien-1-Yl)Benzene |
|---|---|
| Synonyms | (4-bromo-4-butyl-2-fluorocyclohexa-1(6),2-dienyl)benzene; 4-butyl-2-fluoro-4-bromobiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18BrF |
| Molecular Weight | 309.22 |
| CAS Registry Number | 116831-34-6 |
| SMILES | CCCCC1(CC=C(C(=C1)F)c2ccccc2)Br |
| InChI | 1S/C16H18BrF/c1-2-3-10-16(17)11-9-14(15(18)12-16)13-7-5-4-6-8-13/h4-9,12H,2-3,10-11H2,1H3 |
| InChIKey | VVXWOUIREOFZJK-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.858°C at 760 mmHg (Cal.) |
| Flash point | 174.12°C (Cal.) |
| Refractive index | 1.564 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Bromo-4-Butyl-6-Fluoro-1,5-Cyclohexadien-1-Yl)Benzene |