Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(1R,3R)-3-Hydroxy-4-Methylenecyclohexyl]Ethanone |
|---|---|
| Synonyms | 1-((1R,3R)-3-hydroxy-4-methylenecyclohexyl)ethanone |
| Molecular Structure | ![CAS#: 116872-43-6， 1-[(1R,3R)-3-Hydroxy-4-Methylenecyclohexyl]Ethanone](/moreStructures/116872-43-6.gif) |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 |
| CAS Registry Number | 116872-43-6 |
| SMILES | CC(=O)[C@@H]1CCC(=C)[C@@H](C1)O |
| InChI | 1S/C9H14O2/c1-6-3-4-8(7(2)10)5-9(6)11/h8-9,11H,1,3-5H2,2H3/t8-,9-/m1/s1 |
| InChIKey | IUZYGGBTACWBKN-RKDXNWHRSA-N |
| Density | 1.029g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.775°C at 760 mmHg (Cal.) |
| Flash point | 108.148°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(1R,3R)-3-Hydroxy-4-Methylenecyclohexyl]Ethanone |