Online Database of Chemicals from Around the World
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinamide
[CAS# 1169402-51-0]
Identification| Name | 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinamide |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C12H17BN2O3 |
| Molecular Weight | 248.09 |
| CAS Registry Number | 1169402-51-0 |
| EC Number | 681-182-4 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C(=O)N |
|
Properties
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.523, Calc.* |
| Boiling Point | 405.6±30.0 °C (760 mmHg), Calc.* |
| Flash Point | 199.1±24.6 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
4-(4,4,5,5-Tetr... 2-(4,4,5,5-Tetr... 6-(4,4,5,5-Tetr... 7-(4,4,5,5-Tetr... 6-(4,4,5,5-Tetr... 5-(4,4,5,5-Tetr... 4-[(4,4,5,5-Tet... 9-(4,4,5,5-Tetr... 3-(4,4,5,5-Tetr... N-[6-(4,4,5,5-T... 5-(4,4,5,5-Tetr... 2-(4,4,5,5-Tetr... [3-(4,4,5,5-Tet... [2-(4,4,5,5-Tet... 4-[3-(4,4,5,5-T... 2-{2-[4-(4,4,5,... 4-{2-[4-(4,4,5,... 4-(2-[4-(4,4,5,... 1-{2-[4-(4,4,5,... 1-{2-[4-(4,4,5,...