| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Standard >> Forensic and veterinary standards |
|---|---|
| Name | Ofloxacin-d3 |
| Synonyms | 7-fluoro-2-methyl-10-oxo-6-[4-(trideuteriomethyl)piperazin-1-yl]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20FN3O4 |
| Molecular Weight | 364.39 |
| CAS Registry Number | 1173147-91-5 |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C2=C(C=C3C4=C2OCC(N4C=C(C3=O)C(=O)O)C)F |
| Density | 1.5±0.0 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.670, Calc.* |
| Boiling Point | 571.5±0.0 °C (760 mmHg), Calc.* |
| Flash Point | 299.4±0.0 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ofloxacin-d3 |