Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Bis[4-(Vinyloxy)Butyl] Terephthalate |
|---|---|
| Synonyms | Bis[4-(vinyloxy)butyl]terephthalate; VEctomer 4050; 514861_ALDRICH |
| Molecular Structure | ![CAS#: 117397-31-6， Bis[4-(Vinyloxy)Butyl] Terephthalate](/moreStructures/117397-31-6.gif) |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 |
| CAS Registry Number | 117397-31-6 |
| SMILES | O=C(OCCCCO\C=C)c1ccc(C(=O)OCCCCO\C=C)cc1 |
| InChI | 1S/C20H26O6/c1-3-23-13-5-7-15-25-19(21)17-9-11-18(12-10-17)20(22)26-16-8-6-14-24-4-2/h3-4,9-12H,1-2,5-8,13-16H2 |
| InChIKey | HMNFSPVCKZFHGZ-UHFFFAOYSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.44°C at 760 mmHg (Cal.) |
| Flash point | 205.683°C (Cal.) |
| Refractive index | 1.506 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis[4-(Vinyloxy)Butyl] Terephthalate |