Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-(Cyanomethyl)-1-Methyl-1H-Pyrazole-5-Sulfonamide |
|---|---|
| Synonyms | 4-(cyanomethyl)-1-methyl-1H-pyrazole-5-sulfonamide |
| Molecular Structure |  |
| Molecular Formula | C6H8N4O2S |
| Molecular Weight | 200.22 |
| CAS Registry Number | 117519-66-1 |
| SMILES | Cn1c(c(cn1)CC#N)S(=O)(=O)N |
| InChI | 1S/C6H8N4O2S/c1-10-6(13(8,11)12)5(2-3-7)4-9-10/h4H,2H2,1H3,(H2,8,11,12) |
| InChIKey | LFELCGCCBQFKIK-UHFFFAOYSA-N |
| Density | 1.55g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.178°C at 760 mmHg (Cal.) |
| Flash point | 249.041°C (Cal.) |
| Refractive index | 1.667 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Cyanomethyl)-1-Methyl-1H-Pyrazole-5-Sulfonamide |