| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Arginine derivatives |
|---|---|
| Name | 1-[3-(5-Oxo-1-Phenyl-2-Thioxo-4-Imidazolidinyl)Propyl]Guanidine Hydrochloride (1:1) |
| Synonyms | N-[3-(5-o |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18ClN5OS |
| Molecular Weight | 327.83 |
| CAS Registry Number | 117756-28-2 |
| SMILES | c1ccc(cc1)N2C(=O)C(NC2=S)CCCNC(=N)N.Cl |
| InChI | 1S/C13H17N5OS.ClH/c14-12(15)16-8-4-7-10-11(19)18(13(20)17-10)9-5-2-1-3-6-9;/h1-3,5-6,10H,4,7-8H2,(H,17,20)(H4,14,15,16);1H |
| InChIKey | IXKPSQGERWCHMF-UHFFFAOYSA-N |
| Melting point | 188°C (Expl.) |
|---|---|
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(5-Oxo-1-Phenyl-2-Thioxo-4-Imidazolidinyl)Propyl]Guanidine Hydrochloride (1:1) |