Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Nitro-3-Furamide |
|---|---|
| Synonyms | 3-Furancarboxamide,5-nitro-; 5-nitrofuran-3-carboxamide |
| Molecular Structure |  |
| Molecular Formula | C5H4N2O4 |
| Molecular Weight | 156.10 |
| CAS Registry Number | 118739-51-8 |
| SMILES | c1c(coc1[N+](=O)[O-])C(=O)N |
| InChI | 1S/C5H4N2O4/c6-5(8)3-1-4(7(9)10)11-2-3/h1-2H,(H2,6,8) |
| InChIKey | GVIXBLJYKVYGJN-UHFFFAOYSA-N |
| Density | 1.519g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.9°C at 760 mmHg (Cal.) |
| Flash point | 132.756°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitro-3-Furamide |