Online Database of Chemicals from Around the World
|
CAS#: 118747-02-7 Product: 2-Chloromelatonin No suppilers available for the product. |
| Name | 2-Chloromelatonin |
|---|---|
| Synonyms | N-[2-(2-Chloro-5-Methoxy-1H-Indol-3-Yl)Ethyl]Ethanamide; 2-Chloromelatonin; Pdsp1_001794 |
| Molecular Structure |  |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 |
| CAS Registry Number | 118747-02-7 |
| SMILES | C1=C(C=CC2=C1C(=C([NH]2)Cl)CCNC(C)=O)OC |
| InChI | 1S/C13H15ClN2O2/c1-8(17)15-6-5-10-11-7-9(18-2)3-4-12(11)16-13(10)14/h3-4,7,16H,5-6H2,1-2H3,(H,15,17) |
| InChIKey | NCUNCNOQCUAVBX-UHFFFAOYSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 536.245°C at 760 mmHg (Cal.) |
| Flash point | 278.111°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloromelatonin |