|
CAS#: 118797-71-0 Product: 4',5'-Dimethylfluorescein No suppilers available for the product. |
| Name | 4',5'-Dimethylfluorescein |
|---|---|
| Synonyms | 3',6'-Dihydroxy-4',5'-Dimethyl-Spiro[Isobenzofuran-3,9'-Xanthene]-1-One; 3',6'-Dihydroxy-4',5'-Dimethyl-1-Spiro[Isobenzofuran-3,9'-Xanthene]One; 3',6'-Dihydroxy-4',5'-Dimethyl-Spiro[2-Benzofuran-3,9'-Xanthene]-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C22H16O5 |
| Molecular Weight | 360.37 |
| CAS Registry Number | 118797-71-0 |
| SMILES | C4=C3C1(OC(=O)C2=C1C=CC=C2)C5=C(OC3=C(C(=C4)O)C)C(=C(O)C=C5)C |
| InChI | 1S/C22H16O5/c1-11-17(23)9-7-15-19(11)26-20-12(2)18(24)10-8-16(20)22(15)14-6-4-3-5-13(14)21(25)27-22/h3-10,23-24H,1-2H3 |
| InChIKey | KUKOGZJLQJYXRZ-UHFFFAOYSA-N |
| Density | 1.509g/cm3 (Cal.) |
|---|---|
| Boiling point | 607.508°C at 760 mmHg (Cal.) |
| Flash point | 220.768°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4',5'-Dimethylfluorescein |