Online Database of Chemicals from Around the World
|
CAS#: 119239-65-5 Product: Benzo(f)Quinoline-9,10-Diol-7,8-Epoxide No suppilers available for the product. |
| Name | Benzo(f)Quinoline-9,10-Diol-7,8-Epoxide |
|---|---|
| Synonyms | Ccris 2965 |
| Molecular Structure |  |
| Molecular Formula | C13H7NO3 |
| Molecular Weight | 225.20 |
| CAS Registry Number | 119239-65-5 |
| SMILES | O=C4C1=C(O1)C3=CC=C2NC=CC=C2C3=C4O |
| InChI | 1S/C13H7NO3/c15-10-9-6-2-1-5-14-8(6)4-3-7(9)12-13(17-12)11(10)16/h1-5,14-15H |
| InChIKey | AEEOKVQGQXEZES-UHFFFAOYSA-N |
| Density | 1.661g/cm3 (Cal.) |
|---|---|
| Boiling point | 688.222°C at 760 mmHg (Cal.) |
| Flash point | 370.023°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo(f)Quinoline-9,10-Diol-7,8-Epoxide |