Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2R,5S)-5-Acetyltetrahydro-2-Thiophenecarbonitrile |
|---|---|
| Synonyms | (2R,5S)-5-acetyltetrahydrothiophene-2-carbonitrile |
| Molecular Structure |  |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 |
| CAS Registry Number | 119292-52-3 |
| SMILES | CC(=O)[C@@H]1CC[C@@H](S1)C#N |
| InChI | 1S/C7H9NOS/c1-5(9)7-3-2-6(4-8)10-7/h6-7H,2-3H2,1H3/t6-,7+/m1/s1 |
| InChIKey | PWAGMUUFEUJXRK-RQJHMYQMSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.61°C at 760 mmHg (Cal.) |
| Flash point | 150.724°C (Cal.) |
| Refractive index | 1.524 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,5S)-5-Acetyltetrahydro-2-Thiophenecarbonitrile |