Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Chloro-4,5-Dihydroxybenzoyl Chloride |
|---|---|
| Synonyms | 3-chloro-4,5-dihydroxybenzoyl chloride |
| Molecular Structure |  |
| Molecular Formula | C7H4Cl2O3 |
| Molecular Weight | 207.01 |
| CAS Registry Number | 119735-20-5 |
| SMILES | c1c(cc(c(c1O)O)Cl)C(=O)Cl |
| InChI | 1S/C7H4Cl2O3/c8-4-1-3(7(9)12)2-5(10)6(4)11/h1-2,10-11H |
| InChIKey | AXPHXKHORNGRIK-UHFFFAOYSA-N |
| Density | 1.661g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.983°C at 760 mmHg (Cal.) |
| Flash point | 161.231°C (Cal.) |
| Refractive index | 1.644 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-4,5-Dihydroxybenzoyl Chloride |