Online Database of Chemicals from Around the World
|
CAS#: 1199-36-6 Product: 1-Chloro-4-Methylsulfanyl-2-Nitrobenzene No suppilers available for the product. |
| Name | 1-Chloro-4-Methylsulfanyl-2-Nitrobenzene |
|---|---|
| Synonyms | 1-Chloro-4-Methylsulfanyl-2-Nitro-Benzene; 1-Chloro-4-(Methylthio)-2-Nitrobenzene; 1-Chloro-4-(Methylthio)-2-Nitro-Benzene |
| Molecular Structure |  |
| Molecular Formula | C7H6ClNO2S |
| Molecular Weight | 203.64 |
| CAS Registry Number | 1199-36-6 |
| EINECS | 214-843-9 |
| SMILES | C1=CC(=CC(=C1Cl)[N+]([O-])=O)SC |
| InChI | 1S/C7H6ClNO2S/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| InChIKey | UFLRXTNPCRROEB-UHFFFAOYSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.951°C at 760 mmHg (Cal.) |
| Flash point | 133.391°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-Methylsulfanyl-2-Nitrobenzene |