Online Database of Chemicals from Around the World
(E)-2-(2-Ethoxyvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
[CAS# 1201905-61-4]
Identification| Name | (E)-2-(2-Ethoxyvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C6HCl4NO2 |
| Molecular Weight | 198.07 |
| CAS Registry Number | 1201905-61-4 |
| EC Number | 814-906-6 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/OCC |
|
Properties
| Solubility | 6399 mg/L (25 °C water) |
| Density | 0.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.435, Calc.* |
| Melting point | 30.57 °C |
| Boiling Point | 220.24 °C, 198.0±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 73.5±27.9 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Symbols | GHS07 Warning Details |
| Risk Statements | H227-H302-H315-H319-H335 Details |
| Safety Statements | P210-P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P370+P378-P403-P403+P233-P405-P501 Details |
| Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
| Skin irritation | Skin Irrit. | 2 | H315 |
| Eye irritation | Eye Irrit. | 2 | H319 |
| Flammable liquids | Flam. Liq. | 4 | H227 |
| Acute toxicity | Acute Tox. | 4 | H302 |
| Specific target organ toxicity - single exposure | STOT SE | 3 | H335 |
| Eye irritation | Eye Irrit. | 2A | H319 |
|
| SDS | Available |
|
Related Products