Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(3R,5S)-3,5-Dimethyl-4-Morpholinyl]Ethanone |
|---|---|
| Synonyms | 1-((3R,5S)-3,5-dimethylmorpholino)ethanone |
| Molecular Structure | ![CAS#: 120226-28-0， 1-[(3R,5S)-3,5-Dimethyl-4-Morpholinyl]Ethanone](/moreStructures/120226-28-0.gif) |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 |
| CAS Registry Number | 120226-28-0 |
| SMILES | C[C@@H]1COC[C@@H](N1C(=O)C)C |
| InChI | 1S/C8H15NO2/c1-6-4-11-5-7(2)9(6)8(3)10/h6-7H,4-5H2,1-3H3/t6-,7+ |
| InChIKey | MVVAELFNRUZXTC-KNVOCYPGSA-N |
| Density | 0.984g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.102°C at 760 mmHg (Cal.) |
| Flash point | 113.525°C (Cal.) |
| Refractive index | 1.442 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(3R,5S)-3,5-Dimethyl-4-Morpholinyl]Ethanone |