Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4,6-Dimethoxy-2-Pyrimidinyl Methanesulfonate |
|---|---|
| Synonyms | 4,6-dimethoxypyrimidin-2-yl methanesulfonate |
| Molecular Structure |  |
| Molecular Formula | C7H10N2O5S |
| Molecular Weight | 234.23 |
| CAS Registry Number | 120259-57-6 |
| SMILES | COc1cc(nc(n1)OS(=O)(=O)C)OC |
| InChI | 1S/C7H10N2O5S/c1-12-5-4-6(13-2)9-7(8-5)14-15(3,10)11/h4H,1-3H3 |
| InChIKey | HCIXUQJFFHIBSX-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.24°C at 760 mmHg (Cal.) |
| Flash point | 200.697°C (Cal.) |
| Refractive index | 1.507 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dimethoxy-2-Pyrimidinyl Methanesulfonate |