Online Database of Chemicals from Around the World
|
CAS#: 1203-87-8 Product: 3-Amino-6-Chloro-N-(Diaminomethylidene)Pyrazine-2-Carboxamide No suppilers available for the product. |
| Name | 3-Amino-6-Chloro-N-(Diaminomethylidene)Pyrazine-2-Carboxamide |
|---|---|
| Synonyms | 3-Amino-6-Chloro-N-(Diaminomethylene)Pyrazine-2-Carboxamide; 3-Amino-6-Chloro-N-(Diaminomethylene)-2-Pyrazinecarboxamide; 3-Amino-6-Chloro-N-(Diaminomethylene)Pyrazinamide |
| Molecular Structure |  |
| Molecular Formula | C6H7ClN6O |
| Molecular Weight | 214.61 |
| CAS Registry Number | 1203-87-8 |
| SMILES | C1=C(Cl)N=C(C(=N1)N)C(=O)N=C(N)N |
| InChI | 1S/C6H7ClN6O/c7-2-1-11-4(8)3(12-2)5(14)13-6(9)10/h1H,(H2,8,11)(H4,9,10,13,14) |
| InChIKey | PTIMHPOSZRUADS-UHFFFAOYSA-N |
| Density | 1.92g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.37°C at 760 mmHg (Cal.) |
| Flash point | 275.163°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Amino-6-Chloro-N-(Diaminomethylidene)Pyrazine-2-Carboxamide |